C15H12ClN — CID 23633136
(6Z,10aZ,12Z)-benzo[c][1]benzazocine;hydrochloride (PubChem CID 23633136) has the molecular formula C15H12ClN and a molecular weight of 241.72 g/mol. Its IUPAC name is (6Z,10aZ,12Z)-benzo[c][1]benzazocine;hydrochloride.
| Compound Name | (6Z,10aZ,12Z)-benzo[c][1]benzazocine;hydrochloride |
|---|---|
| PubChem CID | 23633136 |
| Molecular Formula | C15H12ClN |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (6Z,10aZ,12Z)-benzo[c][1]benzazocine;hydrochloride |
| SMILES | C1=c2/cccc/c2=C/N=c2/cccc/c2=C/1.Cl |
| InChI | InChI=1S/C15H11N.ClH/c1-2-7-14-11-16-15-8-4-3-6-13(15)10-9-12(14)5-1;/h1-11H;1H/b10-9-,12-9-,13-10-,14-11-,16-11-,16-15-; |
| InChIKey | JMDRKRYAJIEJFU-CSCZKXIASA-N |
| XLogP | 0.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |