C13H19N — CID 91070680
1,6-dimethyl-6,7-dihydroisoquinoline;ethane (PubChem CID 91070680) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,6-dimethyl-6,7-dihydroisoquinoline;ethane.
| Compound Name | 1,6-dimethyl-6,7-dihydroisoquinoline;ethane |
|---|---|
| PubChem CID | 91070680 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1,6-dimethyl-6,7-dihydroisoquinoline;ethane |
| SMILES | CC.Cc1nccc2c1=CCC(C)C=2 |
| InChI | InChI=1S/C11H13N.C2H6/c1-8-3-4-11-9(2)12-6-5-10(11)7-8;1-2/h4-8H,3H2,1-2H3;1-2H3 |
| InChIKey | HIBSWDSMVRPEKT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |