C19H38N+ — CID 123423893
(3-ethyl-3,4,5-trimethylhept-5-en-2-ylidene)-hexyl-methylazanium (PubChem CID 123423893) has the molecular formula C19H38N+ and a molecular weight of 280.52 g/mol. Its IUPAC name is (3-ethyl-3,4,5-trimethylhept-5-en-2-ylidene)-hexyl-methylazanium.
| Compound Name | (3-ethyl-3,4,5-trimethylhept-5-en-2-ylidene)-hexyl-methylazanium |
|---|---|
| PubChem CID | 123423893 |
| Molecular Formula | C19H38N+ |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.30 |
| IUPAC Name | (3-ethyl-3,4,5-trimethylhept-5-en-2-ylidene)-hexyl-methylazanium |
| SMILES | CC=C(C)C(C)C(C)(CC)/C(C)=[N+](\C)CCCCCC |
| InChI | InChI=1S/C19H38N/c1-9-12-13-14-15-20(8)18(6)19(7,11-3)17(5)16(4)10-2/h10,17H,9,11-15H2,1-8H3/q+1/b16-10?,20-18+ |
| InChIKey | ZAGBZCXXNUMIMY-PCDBVBHLSA-N |
| XLogP | 5.69 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|