C27H43N — CID 143347977
(1Z,3Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-10-azabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene (PubChem CID 143347977) has the molecular formula C27H43N and a molecular weight of 381.65 g/mol. Its IUPAC name is (1Z,3Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-10-azabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene.
| Compound Name | (1Z,3Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-10-azabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene |
|---|---|
| PubChem CID | 143347977 |
| Molecular Formula | C27H43N |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | (1Z,3Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-10-azabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene |
| SMILES | CCC(C)C1=CC(C)/C=C2C(=N/C1)\C(C)/C=C\C(C)(C(C)(C)CC)/C=C\C\2C |
| InChI | InChI=1S/C27H43N/c1-10-20(4)23-16-19(3)17-24-21(5)12-14-27(9,26(7,8)11-2)15-13-22(6)25(24)28-18-23/h12-17,19-22H,10-11,18H2,1-9H3/b14-12-,15-13-,23-16?,24-17-,28-25- |
| InChIKey | ORYSQZNRNHXNOL-QRAAITMPSA-N |
| XLogP | 7.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|