C25H40N2 — CID 143347963
(1Z,6Z)-5,12-di(butan-2-yl)-2,5,8,14-tetramethyl-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene (PubChem CID 143347963) has the molecular formula C25H40N2 and a molecular weight of 368.61 g/mol. Its IUPAC name is (1Z,6Z)-5,12-di(butan-2-yl)-2,5,8,14-tetramethyl-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene.
| Compound Name | (1Z,6Z)-5,12-di(butan-2-yl)-2,5,8,14-tetramethyl-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene |
|---|---|
| PubChem CID | 143347963 |
| Molecular Formula | C25H40N2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | (1Z,6Z)-5,12-di(butan-2-yl)-2,5,8,14-tetramethyl-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene |
| SMILES | CCC(C)C1=CC(C)/C=C2C(=N/C1)\C(C)/C=C\C(C)(C(C)CC)/C=N\C\2C |
| InChI | InChI=1S/C25H40N2/c1-9-18(4)22-13-17(3)14-23-21(7)27-16-25(8,20(6)10-2)12-11-19(5)24(23)26-15-22/h11-14,16-21H,9-10,15H2,1-8H3/b12-11-,22-13?,23-14-,26-24-,27-16- |
| InChIKey | ZSXJIWCHCVVFSS-AJEMZSGDSA-N |
| XLogP | 6.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|