C30H45N3 — CID 91457239
N-cyclohexyl-1-(2,3-dimethyl-3-propan-2-yl-2,4-dihydroazepin-6-yl)-3,4-dimethyl-4,5,8,9-tetrahydro-3H-cycloocta[c]pyridin-10-imine (PubChem CID 91457239) has the molecular formula C30H45N3 and a molecular weight of 447.71 g/mol. Its IUPAC name is N-cyclohexyl-1-(2,3-dimethyl-3-propan-2-yl-2,4-dihydroazepin-6-yl)-3,4-dimethyl-4,5,8,9-tetrahydro-3H-cycloocta[c]pyridin-10-imine.
| Compound Name | N-cyclohexyl-1-(2,3-dimethyl-3-propan-2-yl-2,4-dihydroazepin-6-yl)-3,4-dimethyl-4,5,8,9-tetrahydro-3H-cycloocta[c]pyridin-10-imine |
|---|---|
| PubChem CID | 91457239 |
| Molecular Formula | C30H45N3 |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.36 |
| IUPAC Name | N-cyclohexyl-1-(2,3-dimethyl-3-propan-2-yl-2,4-dihydroazepin-6-yl)-3,4-dimethyl-4,5,8,9-tetrahydro-3H-cycloocta[c]pyridin-10-imine |
| SMILES | CC1N=C(C2=CCC(C)(C(C)C)C(C)N=C2)C2=C(CC=CCC/C2=N\C2CCCCC2)C1C |
| InChI | InChI=1S/C30H45N3/c1-20(2)30(6)18-17-24(19-31-23(30)5)29-28-26(21(3)22(4)32-29)15-11-8-12-16-27(28)33-25-13-9-7-10-14-25/h8,11,17,19-23,25H,7,9-10,12-16,18H2,1-6H3/b11-8?,33-27+ |
| InChIKey | UQCJVHVBACIKNY-NORFTSBWSA-N |
| XLogP | 7.73 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|