C26H42N2 — CID 143347975
(1Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene (PubChem CID 143347975) has the molecular formula C26H42N2 and a molecular weight of 382.64 g/mol. Its IUPAC name is (1Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene.
| Compound Name | (1Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene |
|---|---|
| PubChem CID | 143347975 |
| Molecular Formula | C26H42N2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (1Z,6Z)-12-butan-2-yl-2,5,8,14-tetramethyl-5-(2-methylbutan-2-yl)-3,10-diazabicyclo[7.6.0]pentadeca-1(15),3,6,9,12-pentaene |
| SMILES | CCC(C)C1=CC(C)/C=C2C(=N/C1)\C(C)/C=C\C(C)(C(C)(C)CC)/C=N\C\2C |
| InChI | InChI=1S/C26H42N2/c1-10-19(4)22-14-18(3)15-23-21(6)28-17-26(9,25(7,8)11-2)13-12-20(5)24(23)27-16-22/h12-15,17-21H,10-11,16H2,1-9H3/b13-12-,22-14?,23-15-,27-24-,28-17- |
| InChIKey | VGEHERNNDMEXEM-BPOKQIJQSA-N |
| XLogP | 7.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|