C21H33N — CID 123975978
(5E,8Z)-6-tert-butyl-N-(2-cyclopropylpropyl)-2,4-dimethylcyclonona-2,5,8-trien-1-imine (PubChem CID 123975978) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is (5E,8Z)-6-tert-butyl-N-(2-cyclopropylpropyl)-2,4-dimethylcyclonona-2,5,8-trien-1-imine.
| Compound Name | (5E,8Z)-6-tert-butyl-N-(2-cyclopropylpropyl)-2,4-dimethylcyclonona-2,5,8-trien-1-imine |
|---|---|
| PubChem CID | 123975978 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (5E,8Z)-6-tert-butyl-N-(2-cyclopropylpropyl)-2,4-dimethylcyclonona-2,5,8-trien-1-imine |
| SMILES | CC1=CC(C)/C=C(/C(C)(C)C)C/C=C\C1=N/CC(C)C1CC1 |
| InChI | InChI=1S/C21H33N/c1-15-12-16(2)20(22-14-17(3)18-10-11-18)9-7-8-19(13-15)21(4,5)6/h7,9,12-13,15,17-18H,8,10-11,14H2,1-6H3/b9-7-,16-12?,19-13+,22-20+ |
| InChIKey | KXFGRDXVSAUAGH-AIBSKLOESA-N |
| XLogP | 5.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|