C23H37N — CID 123541988
(3E,4E,7Z)-3-ethylidene-5,8-dimethyl-N-(4-methylhexyl)-6-methylideneundeca-4,7,9-trien-2-imine (PubChem CID 123541988) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is (3E,4E,7Z)-3-ethylidene-5,8-dimethyl-N-(4-methylhexyl)-6-methylideneundeca-4,7,9-trien-2-imine.
| Compound Name | (3E,4E,7Z)-3-ethylidene-5,8-dimethyl-N-(4-methylhexyl)-6-methylideneundeca-4,7,9-trien-2-imine |
|---|---|
| PubChem CID | 123541988 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | (3E,4E,7Z)-3-ethylidene-5,8-dimethyl-N-(4-methylhexyl)-6-methylideneundeca-4,7,9-trien-2-imine |
| SMILES | C=C(/C=C(/C)C=CC)/C(C)=C/C(=C\C)/C(C)=N/CCCC(C)CC |
| InChI | InChI=1S/C23H37N/c1-9-13-19(5)16-20(6)21(7)17-23(11-3)22(8)24-15-12-14-18(4)10-2/h9,11,13,16-18H,6,10,12,14-15H2,1-5,7-8H3/b13-9?,19-16-,21-17+,23-11+,24-22+ |
| InChIKey | PJPUSNNGCDHMEI-YUIMFUDGSA-N |
| XLogP | 7.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|