C12H17N — CID 91594120
(8Z)-4,8-dimethyl-3,3a,4,7-tetrahydro-2H-cycloocta[b]pyrrole (PubChem CID 91594120) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (8Z)-4,8-dimethyl-3,3a,4,7-tetrahydro-2H-cycloocta[b]pyrrole.
| Compound Name | (8Z)-4,8-dimethyl-3,3a,4,7-tetrahydro-2H-cycloocta[b]pyrrole |
|---|---|
| PubChem CID | 91594120 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (8Z)-4,8-dimethyl-3,3a,4,7-tetrahydro-2H-cycloocta[b]pyrrole |
| SMILES | C/C1=C/C2=NCCC2C(C)C=CC1 |
| InChI | InChI=1S/C12H17N/c1-9-4-3-5-10(2)11-6-7-13-12(11)8-9/h3,5,8,10-11H,4,6-7H2,1-2H3/b5-3?,9-8- |
| InChIKey | IATLULCBRZWQSJ-XTIARCEMSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|