About 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete
4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete (PubChem CID 91145943) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete.
Analyze 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete?
The IUPAC name of 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete (CID 91145943) is 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete.
What is the SMILES notation for 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete?
The canonical SMILES for 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete is C/C=C(/C)C1=NCC1C.
What is the InChIKey of 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete?
The InChIKey is PIAHMPRYFKDMGI-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H13N/c1-4-6(2)8-7(3)5-9-8/h4,7H,5H2,1-3H3/b6-4-.
What are the key properties of 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete?
4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete has a molecular weight of 123.20 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-but-2-en-2-yl]-3-methyl-2,3-dihydroazete is sourced from PubChem (CID 91145943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).