About 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine
7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine (PubChem CID 123974890) has the molecular formula C27H52N2
and a molecular weight of 404.73 g/mol. Its IUPAC name is 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine.
Molecular Properties
| Compound Name | 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine |
| PubChem CID | 123974890 |
| Molecular Formula | C27H52N2 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 404.41 |
| IUPAC Name | 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine |
| SMILES | CCCCCC(C)=CCCC/C(C)=N/CCC1(C)CN(CCC)CCC(C)(C)C1 |
| InChI | InChI=1S/C27H52N2/c1-8-10-11-14-24(3)15-12-13-16-25(4)28-19-17-27(7)22-26(5,6)18-21-29(23-27)20-9-2/h15H,8-14,16-23H2,1-7H3/b24-15?,28-25+ |
| InChIKey | SIAAQQPHIMUKLN-XEIDDZFGSA-N |
| XLogP | 8.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine?
The IUPAC name of 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine (CID 123974890) is 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine.
What is the SMILES notation for 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine?
The canonical SMILES for 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine is CCCCCC(C)=CCCC/C(C)=N/CCC1(C)CN(CCC)CCC(C)(C)C1.
What is the InChIKey of 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine?
The InChIKey is SIAAQQPHIMUKLN-XEIDDZFGSA-N. The full InChI is InChI=1S/C27H52N2/c1-8-10-11-14-24(3)15-12-13-16-25(4)28-19-17-27(7)22-26(5,6)18-21-29(23-27)20-9-2/h15H,8-14,16-23H2,1-7H3/b24-15?,28-25+.
What are the key properties of 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine?
7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine has a molecular weight of 404.73 g/mol, XLogP of 8.07, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-N-[2-(3,5,5-trimethyl-1-propylazepan-3-yl)ethyl]dodec-6-en-2-imine is sourced from PubChem (CID 123974890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).