C24H48N+ — CID 89169375
2,4-dimethylpent-3-en-2-yl-(5-methylhexan-3-ylidene)-(2,2,5,5-tetramethylhexan-3-yl)azanium (PubChem CID 89169375) has the molecular formula C24H48N+ and a molecular weight of 350.66 g/mol. Its IUPAC name is 2,4-dimethylpent-3-en-2-yl-(5-methylhexan-3-ylidene)-(2,2,5,5-tetramethylhexan-3-yl)azanium.
| Compound Name | 2,4-dimethylpent-3-en-2-yl-(5-methylhexan-3-ylidene)-(2,2,5,5-tetramethylhexan-3-yl)azanium |
|---|---|
| PubChem CID | 89169375 |
| Molecular Formula | C24H48N+ |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.38 |
| IUPAC Name | 2,4-dimethylpent-3-en-2-yl-(5-methylhexan-3-ylidene)-(2,2,5,5-tetramethylhexan-3-yl)azanium |
| SMILES | CC/C(CC(C)C)=[N+](\C(CC(C)(C)C)C(C)(C)C)C(C)(C)C=C(C)C |
| InChI | InChI=1S/C24H48N/c1-14-20(15-18(2)3)25(24(12,13)16-19(4)5)21(23(9,10)11)17-22(6,7)8/h16,18,21H,14-15,17H2,1-13H3/q+1/b25-20- |
| InChIKey | NHLCYPMISLAHNM-QQTULTPQSA-N |
| XLogP | 7.49 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|