C16H21N — CID 156569387
N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 156569387) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-6-methylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-6-methylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 156569387 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-(1,4-diethyl-4-methylcyclobut-2-en-1-yl)-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC=C/C1=N\C1(CC)C=CC1(C)CC |
| InChI | InChI=1S/C16H21N/c1-5-15(4)11-12-16(15,6-2)17-14-10-8-7-9-13(14)3/h7-12H,3,5-6H2,1-2,4H3/b17-14+ |
| InChIKey | YNAYQLFORXWUIQ-SAPNQHFASA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|