C18H23N — CID 142922304
8-but-3-enyl-N,7,7-trimethyl-8H-benzo[7]annulen-6-imine (PubChem CID 142922304) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 8-but-3-enyl-N,7,7-trimethyl-8H-benzo[7]annulen-6-imine.
| Compound Name | 8-but-3-enyl-N,7,7-trimethyl-8H-benzo[7]annulen-6-imine |
|---|---|
| PubChem CID | 142922304 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 8-but-3-enyl-N,7,7-trimethyl-8H-benzo[7]annulen-6-imine |
| SMILES | C=CCCC1C=c2ccccc2=C/C(=N\C)C1(C)C |
| InChI | InChI=1S/C18H23N/c1-5-6-11-16-12-14-9-7-8-10-15(14)13-17(19-4)18(16,2)3/h5,7-10,12-13,16H,1,6,11H2,2-4H3/b19-17+ |
| InChIKey | MDGMRVWOWVQCOU-HTXNQAPBSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|