C18H32N+ — CID 91150296
(4-ethyl-3,4-dimethyl-5-methylidenehept-6-en-3-yl)-methylidene-pent-3-en-2-ylazanium (PubChem CID 91150296) has the molecular formula C18H32N+ and a molecular weight of 262.46 g/mol. Its IUPAC name is (4-ethyl-3,4-dimethyl-5-methylidenehept-6-en-3-yl)-methylidene-pent-3-en-2-ylazanium.
| Compound Name | (4-ethyl-3,4-dimethyl-5-methylidenehept-6-en-3-yl)-methylidene-pent-3-en-2-ylazanium |
|---|---|
| PubChem CID | 91150296 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | (4-ethyl-3,4-dimethyl-5-methylidenehept-6-en-3-yl)-methylidene-pent-3-en-2-ylazanium |
| SMILES | C=CC(=C)C(C)(CC)C(C)(CC)[N+](=C)C(C)C=CC |
| InChI | InChI=1S/C18H32N/c1-10-14-16(6)19(9)18(8,13-4)17(7,12-3)15(5)11-2/h10-11,14,16H,2,5,9,12-13H2,1,3-4,6-8H3/q+1 |
| InChIKey | AUOCDWXXFRNJSB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|