C13H26N+ — CID 123990675
methyl-methylidene-(3,3,4,4-tetramethylhept-5-en-2-yl)azanium (PubChem CID 123990675) has the molecular formula C13H26N+ and a molecular weight of 196.36 g/mol. Its IUPAC name is methyl-methylidene-(3,3,4,4-tetramethylhept-5-en-2-yl)azanium.
| Compound Name | methyl-methylidene-(3,3,4,4-tetramethylhept-5-en-2-yl)azanium |
|---|---|
| PubChem CID | 123990675 |
| Molecular Formula | C13H26N+ |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.21 |
| IUPAC Name | methyl-methylidene-(3,3,4,4-tetramethylhept-5-en-2-yl)azanium |
| SMILES | C=[N+](C)C(C)C(C)(C)C(C)(C)C=CC |
| InChI | InChI=1S/C13H26N/c1-9-10-12(3,4)13(5,6)11(2)14(7)8/h9-11H,7H2,1-6,8H3/q+1 |
| InChIKey | XVLLAQGUQQRJRV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|