C15H28N+ — CID 123601281
methyl-methylidene-(5-methyl-5-prop-1-enylnon-6-en-3-yl)azanium (PubChem CID 123601281) has the molecular formula C15H28N+ and a molecular weight of 222.40 g/mol. Its IUPAC name is methyl-methylidene-(5-methyl-5-prop-1-enylnon-6-en-3-yl)azanium.
| Compound Name | methyl-methylidene-(5-methyl-5-prop-1-enylnon-6-en-3-yl)azanium |
|---|---|
| PubChem CID | 123601281 |
| Molecular Formula | C15H28N+ |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | methyl-methylidene-(5-methyl-5-prop-1-enylnon-6-en-3-yl)azanium |
| SMILES | C=[N+](C)C(CC)CC(C)(C=CC)C=CCC |
| InChI | InChI=1S/C15H28N/c1-7-10-12-15(4,11-8-2)13-14(9-3)16(5)6/h8,10-12,14H,5,7,9,13H2,1-4,6H3/q+1 |
| InChIKey | LCMYANJPPUZJFN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|