C15H29N — CID 163853448
(4S,5Z)-N,N,7-trimethyl-7-propan-2-ylnona-5,8-dien-4-amine (PubChem CID 163853448) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (4S,5Z)-N,N,7-trimethyl-7-propan-2-ylnona-5,8-dien-4-amine.
| Compound Name | (4S,5Z)-N,N,7-trimethyl-7-propan-2-ylnona-5,8-dien-4-amine |
|---|---|
| PubChem CID | 163853448 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (4S,5Z)-N,N,7-trimethyl-7-propan-2-ylnona-5,8-dien-4-amine |
| SMILES | C=CC(C)(/C=C\[C@H](CCC)N(C)C)C(C)C |
| InChI | InChI=1S/C15H29N/c1-8-10-14(16(6)7)11-12-15(5,9-2)13(3)4/h9,11-14H,2,8,10H2,1,3-7H3/b12-11-/t14-,15?/m0/s1 |
| InChIKey | OWHWZNURVYDXBB-VNORQREZSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|