C15H24N+ — CID 123270803
(4-buta-1,3-dien-2-yl-1,4-diethylcyclobut-2-en-1-yl)-ethylidene-methylazanium (PubChem CID 123270803) has the molecular formula C15H24N+ and a molecular weight of 218.36 g/mol. Its IUPAC name is (4-buta-1,3-dien-2-yl-1,4-diethylcyclobut-2-en-1-yl)-ethylidene-methylazanium.
| Compound Name | (4-buta-1,3-dien-2-yl-1,4-diethylcyclobut-2-en-1-yl)-ethylidene-methylazanium |
|---|---|
| PubChem CID | 123270803 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | (4-buta-1,3-dien-2-yl-1,4-diethylcyclobut-2-en-1-yl)-ethylidene-methylazanium |
| SMILES | C=CC(=C)C1(CC)C=CC1(CC)/[N+](C)=C/C |
| InChI | InChI=1S/C15H24N/c1-7-13(5)14(8-2)11-12-15(14,9-3)16(6)10-4/h7,10-12H,1,5,8-9H2,2-4,6H3/q+1/b16-10+ |
| InChIKey | OUQRSHQVFNUHPE-MHWRWJLKSA-N |
| XLogP | 3.58 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|