C13H24N+ — CID 123197091
(2-but-2-en-2-yl-1,2,3-trimethylcyclopropyl)-ethylidene-methylazanium (PubChem CID 123197091) has the molecular formula C13H24N+ and a molecular weight of 194.34 g/mol. Its IUPAC name is (2-but-2-en-2-yl-1,2,3-trimethylcyclopropyl)-ethylidene-methylazanium.
| Compound Name | (2-but-2-en-2-yl-1,2,3-trimethylcyclopropyl)-ethylidene-methylazanium |
|---|---|
| PubChem CID | 123197091 |
| Molecular Formula | C13H24N+ |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | (2-but-2-en-2-yl-1,2,3-trimethylcyclopropyl)-ethylidene-methylazanium |
| SMILES | CC=C(C)C1(C)C(C)C1(C)/[N+](C)=C/C |
| InChI | InChI=1S/C13H24N/c1-8-10(3)12(5)11(4)13(12,6)14(7)9-2/h8-9,11H,1-7H3/q+1/b10-8?,14-9+ |
| InChIKey | ISAOMTVQXUZQIB-ISUDJSGRSA-N |
| XLogP | 3.10 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|