C15H24N+ — CID 123215981
(2-buta-1,3-dien-2-yl-1,2-diethyl-3-methylidenecyclopropyl)-ethylidene-methylazanium (PubChem CID 123215981) has the molecular formula C15H24N+ and a molecular weight of 218.36 g/mol. Its IUPAC name is (2-buta-1,3-dien-2-yl-1,2-diethyl-3-methylidenecyclopropyl)-ethylidene-methylazanium.
| Compound Name | (2-buta-1,3-dien-2-yl-1,2-diethyl-3-methylidenecyclopropyl)-ethylidene-methylazanium |
|---|---|
| PubChem CID | 123215981 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | (2-buta-1,3-dien-2-yl-1,2-diethyl-3-methylidenecyclopropyl)-ethylidene-methylazanium |
| SMILES | C=CC(=C)C1(CC)C(=C)C1(CC)/[N+](C)=C/C |
| InChI | InChI=1S/C15H24N/c1-8-12(5)14(9-2)13(6)15(14,10-3)16(7)11-4/h8,11H,1,5-6,9-10H2,2-4,7H3/q+1/b16-11+ |
| InChIKey | MQSUUAKUISQDJV-LFIBNONCSA-N |
| XLogP | 3.58 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|