C14H22N+ — CID 162436203
4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium (PubChem CID 162436203) has the molecular formula C14H22N+ and a molecular weight of 204.34 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 162436203 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium |
| SMILES | C=C/C=C(\C=C)C1(C)C=[N+](C)C(C)(C)C1 |
| InChI | InChI=1S/C14H22N/c1-7-9-12(8-2)14(5)10-13(3,4)15(6)11-14/h7-9,11H,1-2,10H2,3-6H3/q+1/b12-9+ |
| InChIKey | NSXMWJVWYCTNLS-FMIVXFBMSA-N |
| XLogP | 3.19 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|