C16H28N+ — CID 162436202
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium (PubChem CID 162436202) has the molecular formula C16H28N+ and a molecular weight of 234.41 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium.
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 162436202 |
| Molecular Formula | C16H28N+ |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2,4-tetramethyl-3H-pyrrol-1-ium |
| SMILES | C=C/C=C(\C=C)C1(C)C=[N+](C)C(C)(C)C1.CC |
| InChI | InChI=1S/C14H22N.C2H6/c1-7-9-12(8-2)14(5)10-13(3,4)15(6)11-14;1-2/h7-9,11H,1-2,10H2,3-6H3;1-2H3/q+1;/b12-9+; |
| InChIKey | WIMXKXOEQSSMGQ-NBYYMMLRSA-N |
| XLogP | 4.21 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|