C15H19N — CID 123523602
N-[1-(4-ethylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine (PubChem CID 123523602) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[1-(4-ethylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine.
| Compound Name | N-[1-(4-ethylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 123523602 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-[1-(4-ethylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine |
| SMILES | C=CC=C(/N=C/C=C)C1=CCC(CC)C=C1 |
| InChI | InChI=1S/C15H19N/c1-4-7-15(16-12-5-2)14-10-8-13(6-3)9-11-14/h4-5,7-8,10-13H,1-2,6,9H2,3H3/b15-7?,16-12+ |
| InChIKey | CYXXPJCAIIKOCB-JJGARPFQSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|