About 9bH-benzo[de]quinoline
9bH-benzo[de]quinoline (PubChem CID 57001454) has the molecular formula C12H9N
and a molecular weight of 167.21 g/mol. Its IUPAC name is 9bH-benzo[de]quinoline.
Molecular Properties
| Compound Name | 9bH-benzo[de]quinoline |
| PubChem CID | 57001454 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 9bH-benzo[de]quinoline |
| SMILES | C1=CC2=CC=NC3=CC=CC(=C1)C23 |
| InChI | InChI=1S/C12H9N/c1-3-9-5-2-6-11-12(9)10(4-1)7-8-13-11/h1-8,12H |
| InChIKey | FBWACLVQZNGKGP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 428 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9bH-benzo[de]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9bH-benzo[de]quinoline?
The IUPAC name of 9bH-benzo[de]quinoline (CID 57001454) is 9bH-benzo[de]quinoline.
What is the SMILES notation for 9bH-benzo[de]quinoline?
The canonical SMILES for 9bH-benzo[de]quinoline is C1=CC2=CC=NC3=CC=CC(=C1)C23.
What is the InChIKey of 9bH-benzo[de]quinoline?
The InChIKey is FBWACLVQZNGKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N/c1-3-9-5-2-6-11-12(9)10(4-1)7-8-13-11/h1-8,12H.
What are the key properties of 9bH-benzo[de]quinoline?
9bH-benzo[de]quinoline has a molecular weight of 167.21 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9bH-benzo[de]quinoline is sourced from PubChem (CID 57001454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).