C15H24N+ — CID 123172520
5-ethenyl-4,4-diethyl-1-ethylidene-3-methylidene-2,7-dihydroazepin-1-ium (PubChem CID 123172520) has the molecular formula C15H24N+ and a molecular weight of 218.36 g/mol. Its IUPAC name is 5-ethenyl-4,4-diethyl-1-ethylidene-3-methylidene-2,7-dihydroazepin-1-ium.
| Compound Name | 5-ethenyl-4,4-diethyl-1-ethylidene-3-methylidene-2,7-dihydroazepin-1-ium |
|---|---|
| PubChem CID | 123172520 |
| Molecular Formula | C15H24N+ |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 5-ethenyl-4,4-diethyl-1-ethylidene-3-methylidene-2,7-dihydroazepin-1-ium |
| SMILES | C=CC1=CC/[N+](=C\C)CC(=C)C1(CC)CC |
| InChI | InChI=1S/C15H24N/c1-6-14-10-11-16(9-4)12-13(5)15(14,7-2)8-3/h6,9-10H,1,5,7-8,11-12H2,2-4H3/q+1/b16-9+ |
| InChIKey | HOOJQISFMGQBBI-CXUHLZMHSA-N |
| XLogP | 3.58 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|