C29H48N2 — CID 164902481
(3Z,5Z)-N-[(Z,3R)-3-methylpent-1-enyl]-5-propan-2-ylhepta-3,5-dien-2-imine;(3Z,5Z)-3-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine (PubChem CID 164902481) has the molecular formula C29H48N2 and a molecular weight of 424.72 g/mol. Its IUPAC name is (3Z,5Z)-N-[(Z,3R)-3-methylpent-1-enyl]-5-propan-2-ylhepta-3,5-dien-2-imine;(3Z,5Z)-3-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-N-[(Z,3R)-3-methylpent-1-enyl]-5-propan-2-ylhepta-3,5-dien-2-imine;(3Z,5Z)-3-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 164902481 |
| Molecular Formula | C29H48N2 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 424.38 |
| IUPAC Name | (3Z,5Z)-N-[(Z,3R)-3-methylpent-1-enyl]-5-propan-2-ylhepta-3,5-dien-2-imine;(3Z,5Z)-3-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-3,5-dien-2-imine |
| SMILES | C/C=C(\C=C/C(C)=N/C=C\[C@H](C)CC)C(C)C.C/C=C\C=C(C(/C)=N/C=C\C)\C(C)C |
| InChI | InChI=1S/C16H27N.C13H21N/c1-7-14(5)11-12-17-15(6)9-10-16(8-2)13(3)4;1-6-8-9-13(11(3)4)12(5)14-10-7-2/h8-14H,7H2,1-6H3;6-11H,1-5H3/b10-9-,12-11-,16-8+,17-15+;8-6-,10-7-,13-9-,14-12+/t14-;/m1./s1 |
| InChIKey | UJTLSJXOPIEZKJ-HHFYSHAPSA-N |
| XLogP | 9.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|