C12H17N — CID 89033543
(3Z)-3-ethenyl-N,6-dimethyl-5-methylidenehepta-3,6-dien-2-imine (PubChem CID 89033543) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (3Z)-3-ethenyl-N,6-dimethyl-5-methylidenehepta-3,6-dien-2-imine.
| Compound Name | (3Z)-3-ethenyl-N,6-dimethyl-5-methylidenehepta-3,6-dien-2-imine |
|---|---|
| PubChem CID | 89033543 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3Z)-3-ethenyl-N,6-dimethyl-5-methylidenehepta-3,6-dien-2-imine |
| SMILES | C=CC(=C/C(=C)C(=C)C)/C(C)=N/C |
| InChI | InChI=1S/C12H17N/c1-7-12(11(5)13-6)8-10(4)9(2)3/h7-8H,1-2,4H2,3,5-6H3/b12-8-,13-11+ |
| InChIKey | CDFFFNVCQRJBSH-SYUORULGSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|