C10H14FN — CID 143981182
(4Z)-4-ethenyl-2-fluoro-N-methylhepta-1,4-dien-3-imine (PubChem CID 143981182) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is (4Z)-4-ethenyl-2-fluoro-N-methylhepta-1,4-dien-3-imine.
| Compound Name | (4Z)-4-ethenyl-2-fluoro-N-methylhepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 143981182 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (4Z)-4-ethenyl-2-fluoro-N-methylhepta-1,4-dien-3-imine |
| SMILES | C=C/C(=C/CC)C(=NC)C(=C)F |
| InChI | InChI=1S/C10H14FN/c1-5-7-9(6-2)10(12-4)8(3)11/h6-7H,2-3,5H2,1,4H3/b9-7-,12-10+ |
| InChIKey | VGQTYZZJDAWJTL-LBTWLYDDSA-N |
| XLogP | 3.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|