C12H17N3 — CID 126593773
(3E)-5-methylidene-4-(methylideneamino)-2-prop-2-enyliminohepta-3,6-dien-3-amine (PubChem CID 126593773) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (3E)-5-methylidene-4-(methylideneamino)-2-prop-2-enyliminohepta-3,6-dien-3-amine.
| Compound Name | (3E)-5-methylidene-4-(methylideneamino)-2-prop-2-enyliminohepta-3,6-dien-3-amine |
|---|---|
| PubChem CID | 126593773 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (3E)-5-methylidene-4-(methylideneamino)-2-prop-2-enyliminohepta-3,6-dien-3-amine |
| SMILES | C=CC/N=C(\C)C(N)=C(N=C)C(=C)C=C |
| InChI | InChI=1S/C12H17N3/c1-6-8-15-10(4)11(13)12(14-5)9(3)7-2/h6-7H,1-3,5,8,13H2,4H3/b12-11+,15-10+ |
| InChIKey | IXEPSOSYIBKKIC-LNXXMCPBSA-N |
| XLogP | 2.25 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|