C8H10N2 — CID 89089063
(1Z,3E)-4-(2H-azirin-3-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89089063) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (1Z,3E)-4-(2H-azirin-3-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-(2H-azirin-3-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89089063 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (1Z,3E)-4-(2H-azirin-3-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C=C/N)C1=NC1 |
| InChI | InChI=1S/C8H10N2/c1-2-7(4-3-5-9)8-6-10-8/h2-5H,1,6,9H2/b5-3-,7-4+ |
| InChIKey | HZPIMCHIYQAZNX-XKSOLRDRSA-N |
| XLogP | 1.03 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|