C20H31N3 — CID 142946945
(1E,3Z,5Z,7E)-4,7-dimethyl-9-[(E)-4-methyl-3-(methyliminomethyl)pent-2-en-2-yl]iminodeca-1,3,5,7-tetraen-1-amine (PubChem CID 142946945) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (1E,3Z,5Z,7E)-4,7-dimethyl-9-[(E)-4-methyl-3-(methyliminomethyl)pent-2-en-2-yl]iminodeca-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3Z,5Z,7E)-4,7-dimethyl-9-[(E)-4-methyl-3-(methyliminomethyl)pent-2-en-2-yl]iminodeca-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 142946945 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (1E,3Z,5Z,7E)-4,7-dimethyl-9-[(E)-4-methyl-3-(methyliminomethyl)pent-2-en-2-yl]iminodeca-1,3,5,7-tetraen-1-amine |
| SMILES | C/N=C/C(=C(C)/N=C(C)/C=C(C)/C=C\C(C)=C/C=C/N)C(C)C |
| InChI | InChI=1S/C20H31N3/c1-15(2)20(14-22-7)19(6)23-18(5)13-17(4)11-10-16(3)9-8-12-21/h8-15H,21H2,1-7H3/b11-10-,12-8+,16-9-,17-13+,20-19-,22-14+,23-18+ |
| InChIKey | FEWRJOKBVQFRTN-DGJFDQNSSA-N |
| XLogP | 5.00 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|