C18H29N2+ — CID 59952362
methyl-[4,5,6,7,8-pentamethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium (PubChem CID 59952362) has the molecular formula C18H29N2+ and a molecular weight of 273.44 g/mol. Its IUPAC name is methyl-[4,5,6,7,8-pentamethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium.
| Compound Name | methyl-[4,5,6,7,8-pentamethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium |
|---|---|
| PubChem CID | 59952362 |
| Molecular Formula | C18H29N2+ |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | methyl-[4,5,6,7,8-pentamethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium |
| SMILES | CNC=CC=C(C)C(C)=C(C)C(C)=C(C)C=C/C=[NH+]/C |
| InChI | InChI=1S/C18H28N2/c1-14(10-8-12-19-6)16(3)18(5)17(4)15(2)11-9-13-20-7/h8-13,19H,1-7H3/p+1/b11-9?,12-8?,14-10?,17-15?,18-16?,20-13+ |
| InChIKey | FQXYABKOBFFLTN-BHUZQEPYSA-O |
| XLogP | 2.68 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|