C13H19N2+ — CID 54285233
methyl-[11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium (PubChem CID 54285233) has the molecular formula C13H19N2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is methyl-[11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium.
| Compound Name | methyl-[11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium |
|---|---|
| PubChem CID | 54285233 |
| Molecular Formula | C13H19N2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | methyl-[11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium |
| SMILES | CNC=CC=CC=CC=CC=C/C=[NH+]/C |
| InChI | InChI=1S/C13H18N2/c1-14-12-10-8-6-4-3-5-7-9-11-13-15-2/h3-14H,1-2H3/p+1/b4-3?,7-5?,8-6?,11-9?,12-10?,15-13+ |
| InChIKey | RTQAPGQYFPDAEY-RMDQCRBASA-O |
| XLogP | 0.73 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|