C11H19N2+ — CID 13081060
[(2E,4E,6E)-7-(dimethylamino)hepta-2,4,6-trienylidene]-dimethylazanium (PubChem CID 13081060) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is [(2E,4E,6E)-7-(dimethylamino)hepta-2,4,6-trienylidene]-dimethylazanium.
| Compound Name | [(2E,4E,6E)-7-(dimethylamino)hepta-2,4,6-trienylidene]-dimethylazanium |
|---|---|
| PubChem CID | 13081060 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | [(2E,4E,6E)-7-(dimethylamino)hepta-2,4,6-trienylidene]-dimethylazanium |
| SMILES | CN(C)/C=C/C=C/C=C/C=[N+](C)C |
| InChI | InChI=1S/C11H19N2/c1-12(2)10-8-6-5-7-9-11-13(3)4/h5-11H,1-4H3/q+1 |
| InChIKey | YEFWSFBHAKUJHV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|