C13H21N2+ — CID 12908324
[(2E,4E,6E,8E)-9-(dimethylamino)nona-2,4,6,8-tetraenylidene]-dimethylazanium (PubChem CID 12908324) has the molecular formula C13H21N2+ and a molecular weight of 205.33 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-9-(dimethylamino)nona-2,4,6,8-tetraenylidene]-dimethylazanium.
| Compound Name | [(2E,4E,6E,8E)-9-(dimethylamino)nona-2,4,6,8-tetraenylidene]-dimethylazanium |
|---|---|
| PubChem CID | 12908324 |
| Molecular Formula | C13H21N2+ |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | [(2E,4E,6E,8E)-9-(dimethylamino)nona-2,4,6,8-tetraenylidene]-dimethylazanium |
| SMILES | CN(C)/C=C/C=C/C=C/C=C/C=[N+](C)C |
| InChI | InChI=1S/C13H21N2/c1-14(2)12-10-8-6-5-7-9-11-13-15(3)4/h5-13H,1-4H3/q+1 |
| InChIKey | PCCYPCWNXSZULW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|