C11H14N2 — CID 101185002
(1E,3E,5E,7E,9E)-11-iminoundeca-1,3,5,7,9-pentaen-1-amine (PubChem CID 101185002) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1E,3E,5E,7E,9E)-11-iminoundeca-1,3,5,7,9-pentaen-1-amine.
| Compound Name | (1E,3E,5E,7E,9E)-11-iminoundeca-1,3,5,7,9-pentaen-1-amine |
|---|---|
| PubChem CID | 101185002 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1E,3E,5E,7E,9E)-11-iminoundeca-1,3,5,7,9-pentaen-1-amine |
| SMILES | [H]/N=C/C=C/C=C/C=C/C=C/C=C/N |
| InChI | InChI=1S/C11H14N2/c12-10-8-6-4-2-1-3-5-7-9-11-13/h1-12H,13H2/b3-1+,4-2+,7-5+,8-6+,11-9+,12-10+ |
| InChIKey | BWMGLDGTVDIJHB-CZBFJCMTSA-N |
| XLogP | 2.33 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|