C11H17N2+ — CID 54465327
methyl-[(2E,4E,6E,8E)-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium (PubChem CID 54465327) has the molecular formula C11H17N2+ and a molecular weight of 177.27 g/mol. Its IUPAC name is methyl-[(2E,4E,6E,8E)-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium.
| Compound Name | methyl-[(2E,4E,6E,8E)-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium |
|---|---|
| PubChem CID | 54465327 |
| Molecular Formula | C11H17N2+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | methyl-[(2E,4E,6E,8E)-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium |
| SMILES | CN/C=C/C=C/C=C/C=C/C=[NH+]/C |
| InChI | InChI=1S/C11H16N2/c1-12-10-8-6-4-3-5-7-9-11-13-2/h3-12H,1-2H3/p+1/b5-3+,6-4+,9-7+,10-8+,13-11+ |
| InChIKey | XEKWGWKHIZMQBT-SKDWLBKXSA-O |
| XLogP | 0.17 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|