C12H17IN2 — CID 139566184
(Z,2Z)-2-(2-iodopropylidene)-3-N-[(E)-prop-1-enyl]hex-4-ene-1,3-diimine (PubChem CID 139566184) has the molecular formula C12H17IN2 and a molecular weight of 316.19 g/mol. Its IUPAC name is (Z,2Z)-2-(2-iodopropylidene)-3-N-[(E)-prop-1-enyl]hex-4-ene-1,3-diimine.
| Compound Name | (Z,2Z)-2-(2-iodopropylidene)-3-N-[(E)-prop-1-enyl]hex-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 139566184 |
| Molecular Formula | C12H17IN2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (Z,2Z)-2-(2-iodopropylidene)-3-N-[(E)-prop-1-enyl]hex-4-ene-1,3-diimine |
| SMILES | [H]/N=C/C(=C/C(C)I)C(/C=C\C)=N/C=C/C |
| InChI | InChI=1S/C12H17IN2/c1-4-6-12(15-7-5-2)11(9-14)8-10(3)13/h4-10,14H,1-3H3/b6-4-,7-5+,11-8-,14-9+,15-12+ |
| InChIKey | LRNALFXWJQKCEZ-JTNKUQJTSA-N |
| XLogP | 3.94 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|