C14H21IN4 — CID 138579405
(2E,4E)-4-[[(1E,3Z)-2-(aminomethyl)-4-iodobuta-1,3-dienyl]iminomethyl]-3-ethanimidoylhexa-2,4-dien-2-amine (PubChem CID 138579405) has the molecular formula C14H21IN4 and a molecular weight of 372.25 g/mol. Its IUPAC name is (2E,4E)-4-[[(1E,3Z)-2-(aminomethyl)-4-iodobuta-1,3-dienyl]iminomethyl]-3-ethanimidoylhexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-4-[[(1E,3Z)-2-(aminomethyl)-4-iodobuta-1,3-dienyl]iminomethyl]-3-ethanimidoylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 138579405 |
| Molecular Formula | C14H21IN4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2E,4E)-4-[[(1E,3Z)-2-(aminomethyl)-4-iodobuta-1,3-dienyl]iminomethyl]-3-ethanimidoylhexa-2,4-dien-2-amine |
| SMILES | [H]/N=C(C)/C(C(/C=N/C=C(\C=C/I)CN)=C\C)=C(\C)N |
| InChI | InChI=1S/C14H21IN4/c1-4-13(14(10(2)17)11(3)18)9-19-8-12(7-16)5-6-15/h4-6,8-9,17H,7,16,18H2,1-3H3/b6-5-,12-8+,13-4-,14-11-,17-10+,19-9+ |
| InChIKey | MDIHKUKKSQATPZ-JLMOMRIBSA-N |
| XLogP | 3.07 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|