C14H23N3 — CID 143756108
(Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine (PubChem CID 143756108) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine.
| Compound Name | (Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine |
|---|---|
| PubChem CID | 143756108 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine |
| SMILES | [H]/N=C/C(=C\CNC)/C(=C/N=C(\C)C(=C)C)CC |
| InChI | InChI=1S/C14H23N3/c1-6-13(10-17-12(4)11(2)3)14(9-15)7-8-16-5/h7,9-10,15-16H,2,6,8H2,1,3-5H3/b13-10+,14-7+,15-9+,17-12+ |
| InChIKey | FAXPALXMSIFGGC-COHIGINESA-N |
| XLogP | 3.11 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|