C11H21N2+ — CID 123297385
dimethyl-[5-methyl-4-(methylamino)hepta-2,4-dienylidene]azanium (PubChem CID 123297385) has the molecular formula C11H21N2+ and a molecular weight of 181.30 g/mol. Its IUPAC name is dimethyl-[5-methyl-4-(methylamino)hepta-2,4-dienylidene]azanium.
| Compound Name | dimethyl-[5-methyl-4-(methylamino)hepta-2,4-dienylidene]azanium |
|---|---|
| PubChem CID | 123297385 |
| Molecular Formula | C11H21N2+ |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | dimethyl-[5-methyl-4-(methylamino)hepta-2,4-dienylidene]azanium |
| SMILES | CCC(C)=C(C=CC=[N+](C)C)NC |
| InChI | InChI=1S/C11H21N2/c1-6-10(2)11(12-3)8-7-9-13(4)5/h7-9,12H,6H2,1-5H3/q+1 |
| InChIKey | UILAWVPFUVWGFZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|