C13H22N2 — CID 178138423
(2E,4E)-N-methyl-5-[[(Z)-prop-1-enyl]iminomethyl]octa-2,4-dien-3-amine (PubChem CID 178138423) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (2E,4E)-N-methyl-5-[[(Z)-prop-1-enyl]iminomethyl]octa-2,4-dien-3-amine.
| Compound Name | (2E,4E)-N-methyl-5-[[(Z)-prop-1-enyl]iminomethyl]octa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 178138423 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (2E,4E)-N-methyl-5-[[(Z)-prop-1-enyl]iminomethyl]octa-2,4-dien-3-amine |
| SMILES | C/C=C\N=C\C(=C\C(=C/C)NC)CCC |
| InChI | InChI=1S/C13H22N2/c1-5-8-12(11-15-9-6-2)10-13(7-3)14-4/h6-7,9-11,14H,5,8H2,1-4H3/b9-6-,12-10+,13-7+,15-11+ |
| InChIKey | GIAIUUVKNIPLCH-FDKBKFJISA-N |
| XLogP | 3.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|