C21H34FN3 — CID 137247884
3-[[(3E,5E)-9-fluoro-3,5,9-trimethyldeca-3,5-dien-2-yl]iminomethyl]-N,2-dimethyl-1,4-dihydropyridin-4-amine (PubChem CID 137247884) has the molecular formula C21H34FN3 and a molecular weight of 347.52 g/mol. Its IUPAC name is 3-[[(3E,5E)-9-fluoro-3,5,9-trimethyldeca-3,5-dien-2-yl]iminomethyl]-N,2-dimethyl-1,4-dihydropyridin-4-amine.
| Compound Name | 3-[[(3E,5E)-9-fluoro-3,5,9-trimethyldeca-3,5-dien-2-yl]iminomethyl]-N,2-dimethyl-1,4-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 137247884 |
| Molecular Formula | C21H34FN3 |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 3-[[(3E,5E)-9-fluoro-3,5,9-trimethyldeca-3,5-dien-2-yl]iminomethyl]-N,2-dimethyl-1,4-dihydropyridin-4-amine |
| SMILES | CNC1C=CNC(C)=C1/C=N/C(C)/C(C)=C/C(C)=C/CCC(C)(C)F |
| InChI | InChI=1S/C21H34FN3/c1-15(9-8-11-21(5,6)22)13-16(2)17(3)25-14-19-18(4)24-12-10-20(19)23-7/h9-10,12-14,17,20,23-24H,8,11H2,1-7H3/b15-9+,16-13+,25-14+ |
| InChIKey | WTFJJPZHYDGRRG-GIXUSPFSSA-N |
| XLogP | 4.85 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|