C22H36N2 — CID 174092895
5-(3,3-dimethylcyclobutyl)imino-N-[(3Z)-hexa-1,3-dien-2-yl]-4-methyl-2-(2-methylpropyl)penta-1,3-dien-1-amine (PubChem CID 174092895) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 5-(3,3-dimethylcyclobutyl)imino-N-[(3Z)-hexa-1,3-dien-2-yl]-4-methyl-2-(2-methylpropyl)penta-1,3-dien-1-amine.
| Compound Name | 5-(3,3-dimethylcyclobutyl)imino-N-[(3Z)-hexa-1,3-dien-2-yl]-4-methyl-2-(2-methylpropyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 174092895 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 5-(3,3-dimethylcyclobutyl)imino-N-[(3Z)-hexa-1,3-dien-2-yl]-4-methyl-2-(2-methylpropyl)penta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\CC)NC=C(C=C(C)/C=N/C1CC(C)(C)C1)CC(C)C |
| InChI | InChI=1S/C22H36N2/c1-8-9-10-19(5)23-16-20(11-17(2)3)12-18(4)15-24-21-13-22(6,7)14-21/h9-10,12,15-17,21,23H,5,8,11,13-14H2,1-4,6-7H3/b10-9-,18-12?,20-16?,24-15+ |
| InChIKey | LHZNOHJCMVYASP-LNBQSHRNSA-N |
| XLogP | 6.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|