C25H42N2 — CID 142330018
(3E,5Z)-2,3-diethyl-N-methyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]octa-3,5-dien-1-imine;N-methylprop-1-en-2-amine (PubChem CID 142330018) has the molecular formula C25H42N2 and a molecular weight of 370.63 g/mol. Its IUPAC name is (3E,5Z)-2,3-diethyl-N-methyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]octa-3,5-dien-1-imine;N-methylprop-1-en-2-amine.
| Compound Name | (3E,5Z)-2,3-diethyl-N-methyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]octa-3,5-dien-1-imine;N-methylprop-1-en-2-amine |
|---|---|
| PubChem CID | 142330018 |
| Molecular Formula | C25H42N2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | (3E,5Z)-2,3-diethyl-N-methyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]octa-3,5-dien-1-imine;N-methylprop-1-en-2-amine |
| SMILES | C=C(C)NC.C=C/C=C\C(=C/CC)C(/C=N/C)(CC)/C(=C/C=C\CC)CC |
| InChI | InChI=1S/C21H33N.C4H9N/c1-7-12-14-17-19(10-4)21(11-5,18-22-6)20(15-9-3)16-13-8-2;1-4(2)5-3/h8,12-18H,2,7,9-11H2,1,3-6H3;5H,1H2,2-3H3/b14-12-,16-13-,19-17+,20-15+,22-18+; |
| InChIKey | UIQIBIHYDPULOH-RCLMEFMPSA-N |
| XLogP | 7.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|