C18H34N2 — CID 143423159
but-1-ene;ethane;2-[3-ethenyl-1-methyl-2-(methylideneamino)cyclopent-2-en-1-yl]-N-methylethanamine (PubChem CID 143423159) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is but-1-ene;ethane;2-[3-ethenyl-1-methyl-2-(methylideneamino)cyclopent-2-en-1-yl]-N-methylethanamine.
| Compound Name | but-1-ene;ethane;2-[3-ethenyl-1-methyl-2-(methylideneamino)cyclopent-2-en-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 143423159 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | but-1-ene;ethane;2-[3-ethenyl-1-methyl-2-(methylideneamino)cyclopent-2-en-1-yl]-N-methylethanamine |
| SMILES | C=CC1=C(N=C)C(C)(CCNC)CC1.C=CCC.CC |
| InChI | InChI=1S/C12H20N2.C4H8.C2H6/c1-5-10-6-7-12(2,8-9-13-3)11(10)14-4;1-3-4-2;1-2/h5,13H,1,4,6-9H2,2-3H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | YKXNQOIUCPLMCD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|