C23H35N3 — CID 142939288
ethane;(1E,4Z,6Z)-3-[2-methanimidoyl-4-(7-methyl-3H-azepin-6-yl)butylidene]-N-methylocta-1,4,6-trien-1-amine (PubChem CID 142939288) has the molecular formula C23H35N3 and a molecular weight of 353.55 g/mol. Its IUPAC name is ethane;(1E,4Z,6Z)-3-[2-methanimidoyl-4-(7-methyl-3H-azepin-6-yl)butylidene]-N-methylocta-1,4,6-trien-1-amine.
| Compound Name | ethane;(1E,4Z,6Z)-3-[2-methanimidoyl-4-(7-methyl-3H-azepin-6-yl)butylidene]-N-methylocta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142939288 |
| Molecular Formula | C23H35N3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | ethane;(1E,4Z,6Z)-3-[2-methanimidoyl-4-(7-methyl-3H-azepin-6-yl)butylidene]-N-methylocta-1,4,6-trien-1-amine |
| SMILES | CC.[H]/N=C/C(C=C(/C=C\C=C/C)/C=C/NC)CCC1=C(C)N=CCC=C1 |
| InChI | InChI=1S/C21H29N3.C2H6/c1-4-5-6-9-19(13-15-23-3)16-20(17-22)11-12-21-10-7-8-14-24-18(21)2;1-2/h4-7,9-10,13-17,20,22-23H,8,11-12H2,1-3H3;1-2H3/b5-4-,9-6-,15-13+,19-16?,22-17+; |
| InChIKey | FYHYUDYBGMNPSQ-VCSNLOINSA-N |
| XLogP | 6.16 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|