C22H34N2 — CID 143914141
ethane;(1Z,4E,6Z,7Z)-5-ethenyl-N-methyl-6-(2-methyliminoethylidene)-3-[(1Z,3Z)-penta-1,3-dienyl]nona-1,4,7-trien-1-amine (PubChem CID 143914141) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is ethane;(1Z,4E,6Z,7Z)-5-ethenyl-N-methyl-6-(2-methyliminoethylidene)-3-[(1Z,3Z)-penta-1,3-dienyl]nona-1,4,7-trien-1-amine.
| Compound Name | ethane;(1Z,4E,6Z,7Z)-5-ethenyl-N-methyl-6-(2-methyliminoethylidene)-3-[(1Z,3Z)-penta-1,3-dienyl]nona-1,4,7-trien-1-amine |
|---|---|
| PubChem CID | 143914141 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | ethane;(1Z,4E,6Z,7Z)-5-ethenyl-N-methyl-6-(2-methyliminoethylidene)-3-[(1Z,3Z)-penta-1,3-dienyl]nona-1,4,7-trien-1-amine |
| SMILES | C=CC(=CC(/C=C\C=C/C)/C=C\NC)C(/C=C\C)=C\C=N\C.CC |
| InChI | InChI=1S/C20H28N2.C2H6/c1-6-9-10-12-18(13-15-21-4)17-19(8-3)20(11-7-2)14-16-22-5;1-2/h6-18,21H,3H2,1-2,4-5H3;1-2H3/b9-6-,11-7-,12-10-,15-13-,19-17+,20-14-,22-16+; |
| InChIKey | BIPCNCBKYGYFJS-XTOQVGIJSA-N |
| XLogP | 5.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|